C21H23FN2O3 — CID 112774127
3-[2-(2,5-dimethylphenoxy)ethyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 112774127) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is 3-[2-(2,5-dimethylphenoxy)ethyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,5-dimethylphenoxy)ethyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 112774127 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-[2-(2,5-dimethylphenoxy)ethyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(F)cc2)NC(=O)N(CCOc2cc(C)ccc2C)C1=O |
| InChI | InChI=1S/C21H23FN2O3/c1-4-21(16-7-9-17(22)10-8-16)19(25)24(20(26)23-21)11-12-27-18-13-14(2)5-6-15(18)3/h5-10,13H,4,11-12H2,1-3H3,(H,23,26) |
| InChIKey | PBGHSILCBOBDRQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|