C20H21FN2O3 — CID 7181227
(5S)-5-ethyl-5-(4-fluorophenyl)-3-[2-(4-methylphenoxy)ethyl]imidazolidine-2,4-dione (PubChem CID 7181227) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is (5S)-5-ethyl-5-(4-fluorophenyl)-3-[2-(4-methylphenoxy)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-ethyl-5-(4-fluorophenyl)-3-[2-(4-methylphenoxy)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7181227 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (5S)-5-ethyl-5-(4-fluorophenyl)-3-[2-(4-methylphenoxy)ethyl]imidazolidine-2,4-dione |
| SMILES | CC[C@@]1(c2ccc(F)cc2)NC(=O)N(CCOc2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C20H21FN2O3/c1-3-20(15-6-8-16(21)9-7-15)18(24)23(19(25)22-20)12-13-26-17-10-4-14(2)5-11-17/h4-11H,3,12-13H2,1-2H3,(H,22,25)/t20-/m0/s1 |
| InChIKey | JABXMIXSYGSDBT-FQEVSTJZSA-N |
| XLogP | 3.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|