C17H24N2O3 — CID 84601494
3-[2-(2,5-dimethylphenoxy)ethyl]-5,5-diethylimidazolidine-2,4-dione (PubChem CID 84601494) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-[2-(2,5-dimethylphenoxy)ethyl]-5,5-diethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,5-dimethylphenoxy)ethyl]-5,5-diethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 84601494 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 3-[2-(2,5-dimethylphenoxy)ethyl]-5,5-diethylimidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(CCOc2cc(C)ccc2C)C1=O |
| InChI | InChI=1S/C17H24N2O3/c1-5-17(6-2)15(20)19(16(21)18-17)9-10-22-14-11-12(3)7-8-13(14)4/h7-8,11H,5-6,9-10H2,1-4H3,(H,18,21) |
| InChIKey | QTTMJCFVHZKFCL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|