C19H28N2O4 — CID 18086974
5-butyl-3-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione (PubChem CID 18086974) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 5-butyl-3-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-butyl-3-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18086974 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 5-butyl-3-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCCC1(C)NC(=O)N(CC(O)COc2cc(C)ccc2C)C1=O |
| InChI | InChI=1S/C19H28N2O4/c1-5-6-9-19(4)17(23)21(18(24)20-19)11-15(22)12-25-16-10-13(2)7-8-14(16)3/h7-8,10,15,22H,5-6,9,11-12H2,1-4H3,(H,20,24) |
| InChIKey | MRAXDDSQJNHLBW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|