C25H26N2O4 — CID 46796949
3-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 46796949) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 3-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46796949 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(C)c(OCC(O)CN2C(=O)NC(C)(c3ccc4ccccc4c3)C2=O)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-16-8-9-17(2)22(12-16)31-15-21(28)14-27-23(29)25(3,26-24(27)30)20-11-10-18-6-4-5-7-19(18)13-20/h4-13,21,28H,14-15H2,1-3H3,(H,26,30) |
| InChIKey | NLNPRHNZYPQSOJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|