C22H24N2O4 — CID 46613397
5-(2,3-dihydro-1H-inden-5-yl)-3-(2-hydroxy-3-phenoxypropyl)-5-methylimidazolidine-2,4-dione (PubChem CID 46613397) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yl)-3-(2-hydroxy-3-phenoxypropyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yl)-3-(2-hydroxy-3-phenoxypropyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46613397 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yl)-3-(2-hydroxy-3-phenoxypropyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3c(c2)CCC3)NC(=O)N(CC(O)COc2ccccc2)C1=O |
| InChI | InChI=1S/C22H24N2O4/c1-22(17-11-10-15-6-5-7-16(15)12-17)20(26)24(21(27)23-22)13-18(25)14-28-19-8-3-2-4-9-19/h2-4,8-12,18,25H,5-7,13-14H2,1H3,(H,23,27) |
| InChIKey | WYAFUOXYIUJPGU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|