C22H22Cl2N2O4 — CID 75671649
3-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-5-(2,3-dihydro-1H-inden-5-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 75671649) has the molecular formula C22H22Cl2N2O4 and a molecular weight of 449.33 g/mol. Its IUPAC name is 3-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-5-(2,3-dihydro-1H-inden-5-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-5-(2,3-dihydro-1H-inden-5-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75671649 |
| Molecular Formula | C22H22Cl2N2O4 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 3-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-5-(2,3-dihydro-1H-inden-5-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3c(c2)CCC3)NC(=O)N(CC(O)COc2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C22H22Cl2N2O4/c1-22(15-6-5-13-3-2-4-14(13)9-15)20(28)26(21(29)25-22)11-17(27)12-30-19-8-7-16(23)10-18(19)24/h5-10,17,27H,2-4,11-12H2,1H3,(H,25,29) |
| InChIKey | SWBVTZWBLSDMSY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|