C22H22Cl2N2O5 — CID 26715930
(5R)-5-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-(4-propanoylphenoxy)propyl]-5-methylimidazolidine-2,4-dione (PubChem CID 26715930) has the molecular formula C22H22Cl2N2O5 and a molecular weight of 465.33 g/mol. Its IUPAC name is (5R)-5-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-(4-propanoylphenoxy)propyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-(4-propanoylphenoxy)propyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26715930 |
| Molecular Formula | C22H22Cl2N2O5 |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | (5R)-5-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-(4-propanoylphenoxy)propyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCC(=O)c1ccc(OC[C@H](O)CN2C(=O)N[C@](C)(c3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C22H22Cl2N2O5/c1-3-19(28)13-4-7-16(8-5-13)31-12-15(27)11-26-20(29)22(2,25-21(26)30)17-9-6-14(23)10-18(17)24/h4-10,15,27H,3,11-12H2,1-2H3,(H,25,30)/t15-,22-/m1/s1 |
| InChIKey | JHPQHJRYLRDBGV-IVZQSRNASA-N |
| XLogP | 3.79 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|