C23H26Cl2N4O3 — CID 95342863
(5S)-5-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-5-methylimidazolidine-2,4-dione (PubChem CID 95342863) has the molecular formula C23H26Cl2N4O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is (5S)-5-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95342863 |
| Molecular Formula | C23H26Cl2N4O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (5S)-5-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc(Cl)cc2Cl)NC(=O)N(C[C@H](O)CN2CCN(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C23H26Cl2N4O3/c1-23(19-8-7-16(24)13-20(19)25)21(31)29(22(32)26-23)15-18(30)14-27-9-11-28(12-10-27)17-5-3-2-4-6-17/h2-8,13,18,30H,9-12,14-15H2,1H3,(H,26,32)/t18-,23+/m1/s1 |
| InChIKey | LQSYETGWEYBFAU-JPYJTQIMSA-N |
| XLogP | 2.94 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|