C24H26Cl2N4O3 — CID 41139200
N-[4-(azepan-1-yl)phenyl]-2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 41139200) has the molecular formula C24H26Cl2N4O3 and a molecular weight of 489.40 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 41139200 |
| Molecular Formula | C24H26Cl2N4O3 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@]1(c2ccc(Cl)cc2Cl)NC(=O)N(CC(=O)Nc2ccc(N3CCCCCC3)cc2)C1=O |
| InChI | InChI=1S/C24H26Cl2N4O3/c1-24(19-11-6-16(25)14-20(19)26)22(32)30(23(33)28-24)15-21(31)27-17-7-9-18(10-8-17)29-12-4-2-3-5-13-29/h6-11,14H,2-5,12-13,15H2,1H3,(H,27,31)(H,28,33)/t24-/m0/s1 |
| InChIKey | JMHGLXGUUJPPQV-DEOSSOPVSA-N |
| XLogP | 4.78 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|