C23H24Cl2N4O3 — CID 42921192
2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 42921192) has the molecular formula C23H24Cl2N4O3 and a molecular weight of 475.38 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 42921192 |
| Molecular Formula | C23H24Cl2N4O3 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CN2C(=O)NC(C)(c3ccc(Cl)cc3Cl)C2=O)ccc1N1CCCC1 |
| InChI | InChI=1S/C23H24Cl2N4O3/c1-14-11-16(6-8-19(14)28-9-3-4-10-28)26-20(30)13-29-21(31)23(2,27-22(29)32)17-7-5-15(24)12-18(17)25/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H,26,30)(H,27,32) |
| InChIKey | IWLQMMXJFHAYLH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|