C24H28N4O3 — CID 42897977
2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 42897977) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 42897977 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)Nc3ccc(N4CCCCC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-17-6-8-18(9-7-17)24(2)22(30)28(23(31)26-24)16-21(29)25-19-10-12-20(13-11-19)27-14-4-3-5-15-27/h6-13H,3-5,14-16H2,1-2H3,(H,25,29)(H,26,31) |
| InChIKey | CQGAODMKAPZJTK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|