C19H25Cl2N3O3 — CID 47556171
5-(2,4-dichlorophenyl)-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione (PubChem CID 47556171) has the molecular formula C19H25Cl2N3O3 and a molecular weight of 414.33 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,4-dichlorophenyl)-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47556171 |
| Molecular Formula | C19H25Cl2N3O3 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1CCN(CC(O)CN2C(=O)NC(C)(c3ccc(Cl)cc3Cl)C2=O)CC1 |
| InChI | InChI=1S/C19H25Cl2N3O3/c1-12-5-7-23(8-6-12)10-14(25)11-24-17(26)19(2,22-18(24)27)15-4-3-13(20)9-16(15)21/h3-4,9,12,14,25H,5-8,10-11H2,1-2H3,(H,22,27) |
| InChIKey | CWMPWBOXWPKGEP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|