C18H21Cl2N3O3 — CID 7264423
(5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 7264423) has the molecular formula C18H21Cl2N3O3 and a molecular weight of 398.29 g/mol. Its IUPAC name is (5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7264423 |
| Molecular Formula | C18H21Cl2N3O3 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | C[C@@H]1CCCCN1C(=O)CN1C(=O)N[C@@](C)(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C18H21Cl2N3O3/c1-11-5-3-4-8-22(11)15(24)10-23-16(25)18(2,21-17(23)26)13-7-6-12(19)9-14(13)20/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,21,26)/t11-,18+/m1/s1 |
| InChIKey | OEGAHXBJQRBBQM-ZMZPIMSZSA-N |
| XLogP | 3.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|