C20H21Cl2N5O3 — CID 46583141
N-(2-cyclopentylpyrazol-3-yl)-2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 46583141) has the molecular formula C20H21Cl2N5O3 and a molecular weight of 450.33 g/mol. Its IUPAC name is N-(2-cyclopentylpyrazol-3-yl)-2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-cyclopentylpyrazol-3-yl)-2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 46583141 |
| Molecular Formula | C20H21Cl2N5O3 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-(2-cyclopentylpyrazol-3-yl)-2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1(c2ccc(Cl)cc2Cl)NC(=O)N(CC(=O)Nc2ccnn2C2CCCC2)C1=O |
| InChI | InChI=1S/C20H21Cl2N5O3/c1-20(14-7-6-12(21)10-15(14)22)18(29)26(19(30)25-20)11-17(28)24-16-8-9-23-27(16)13-4-2-3-5-13/h6-10,13H,2-5,11H2,1H3,(H,24,28)(H,25,30) |
| InChIKey | RQJLXWWXHHQGGF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|