C20H22ClN5O3 — CID 43022359
2-[4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-cyclopentylpyrazol-3-yl)acetamide (PubChem CID 43022359) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-cyclopentylpyrazol-3-yl)acetamide.
| Compound Name | 2-[4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-cyclopentylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 43022359 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-cyclopentylpyrazol-3-yl)acetamide |
| SMILES | CC1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)Nc2ccnn2C2CCCC2)C1=O |
| InChI | InChI=1S/C20H22ClN5O3/c1-20(13-6-8-14(21)9-7-13)18(28)25(19(29)24-20)12-17(27)23-16-10-11-22-26(16)15-4-2-3-5-15/h6-11,15H,2-5,12H2,1H3,(H,23,27)(H,24,29) |
| InChIKey | SBGZHWPIZFHOQS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|