C16H18ClN3O3S — CID 99180754
2-(4-chlorophenyl)sulfonyl-N-(2-cyclopentylpyrazol-3-yl)acetamide (PubChem CID 99180754) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-(2-cyclopentylpyrazol-3-yl)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-(2-cyclopentylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 99180754 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-(2-cyclopentylpyrazol-3-yl)acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc(Cl)cc1)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C16H18ClN3O3S/c17-12-5-7-14(8-6-12)24(22,23)11-16(21)19-15-9-10-18-20(15)13-3-1-2-4-13/h5-10,13H,1-4,11H2,(H,19,21) |
| InChIKey | UMOWQGIJKCGSLG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |