C19H26N4O3 — CID 78772114
N-(2-cyclohexylpyrazol-3-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide (PubChem CID 78772114) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(2-cyclohexylpyrazol-3-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide.
| Compound Name | N-(2-cyclohexylpyrazol-3-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 78772114 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-(2-cyclohexylpyrazol-3-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)C2CCCCC2C1=O)Nc1ccnn1C1CCCCC1 |
| InChI | InChI=1S/C19H26N4O3/c24-17(12-22-18(25)14-8-4-5-9-15(14)19(22)26)21-16-10-11-20-23(16)13-6-2-1-3-7-13/h10-11,13-15H,1-9,12H2,(H,21,24) |
| InChIKey | GZKWPYPKIDQXEM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|