C15H22N4O3 — CID 119910318
(2S)-1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]pyrrolidine-2-carboxylic acid (PubChem CID 119910318) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2S)-1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119910318 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2S)-1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(CN1CCC[C@H]1C(=O)O)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C15H22N4O3/c20-14(10-18-9-3-6-12(18)15(21)22)17-13-7-8-16-19(13)11-4-1-2-5-11/h7-8,11-12H,1-6,9-10H2,(H,17,20)(H,21,22)/t12-/m0/s1 |
| InChIKey | IUMAFJCKFPQEOQ-LBPRGKRZSA-N |
| XLogP | 1.49 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |