C9H12ClN3O — CID 166407634
2-chloro-N-(2-cyclobutylpyrazol-3-yl)acetamide (PubChem CID 166407634) has the molecular formula C9H12ClN3O and a molecular weight of 213.67 g/mol. Its IUPAC name is 2-chloro-N-(2-cyclobutylpyrazol-3-yl)acetamide.
| Compound Name | 2-chloro-N-(2-cyclobutylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 166407634 |
| Molecular Formula | C9H12ClN3O |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-chloro-N-(2-cyclobutylpyrazol-3-yl)acetamide |
| SMILES | O=C(CCl)Nc1ccnn1C1CCC1 |
| InChI | InChI=1S/C9H12ClN3O/c10-6-9(14)12-8-4-5-11-13(8)7-2-1-3-7/h4-5,7H,1-3,6H2,(H,12,14) |
| InChIKey | UIUYDEUJNRMGFK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|