C11H17N3O2 — CID 110470599
ethyl N-(2-cyclopentylpyrazol-3-yl)carbamate (PubChem CID 110470599) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is ethyl N-(2-cyclopentylpyrazol-3-yl)carbamate.
| Compound Name | ethyl N-(2-cyclopentylpyrazol-3-yl)carbamate |
|---|---|
| PubChem CID | 110470599 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | ethyl N-(2-cyclopentylpyrazol-3-yl)carbamate |
| SMILES | CCOC(=O)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C11H17N3O2/c1-2-16-11(15)13-10-7-8-12-14(10)9-5-3-4-6-9/h7-9H,2-6H2,1H3,(H,13,15) |
| InChIKey | XHKYXBFJPWVNTQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |