C18H21N3O4 — CID 16512091
[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-hydroxy-5-methylbenzoate (PubChem CID 16512091) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-hydroxy-5-methylbenzoate.
| Compound Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-hydroxy-5-methylbenzoate |
|---|---|
| PubChem CID | 16512091 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-hydroxy-5-methylbenzoate |
| SMILES | Cc1ccc(O)c(C(=O)OCC(=O)Nc2ccnn2C2CCCC2)c1 |
| InChI | InChI=1S/C18H21N3O4/c1-12-6-7-15(22)14(10-12)18(24)25-11-17(23)20-16-8-9-19-21(16)13-4-2-3-5-13/h6-10,13,22H,2-5,11H2,1H3,(H,20,23) |
| InChIKey | OZAAZRYZMDHPIV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |