C18H18F3N3O3 — CID 7838131
[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(trifluoromethyl)benzoate (PubChem CID 7838131) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(trifluoromethyl)benzoate.
| Compound Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7838131 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(trifluoromethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1C(F)(F)F)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C18H18F3N3O3/c19-18(20,21)14-8-4-3-7-13(14)17(26)27-11-16(25)23-15-9-10-22-24(15)12-5-1-2-6-12/h3-4,7-10,12H,1-2,5-6,11H2,(H,23,25) |
| InChIKey | JOIHYFHNPOSUIZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |