C18H20FN3O4 — CID 9140097
[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate (PubChem CID 9140097) has the molecular formula C18H20FN3O4 and a molecular weight of 361.37 g/mol. Its IUPAC name is [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate.
| Compound Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 9140097 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccccc1F)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C18H20FN3O4/c19-14-7-3-4-8-15(14)25-12-18(24)26-11-17(23)21-16-9-10-20-22(16)13-5-1-2-6-13/h3-4,7-10,13H,1-2,5-6,11-12H2,(H,21,23) |
| InChIKey | ALDFSISLLNGWQE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |