C19H20FN3O3 — CID 8663739
[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 8663739) has the molecular formula C19H20FN3O3 and a molecular weight of 357.38 g/mol. Its IUPAC name is [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8663739 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(F)cc1)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C19H20FN3O3/c20-15-8-5-14(6-9-15)7-10-19(25)26-13-18(24)22-17-11-12-21-23(17)16-3-1-2-4-16/h5-12,16H,1-4,13H2,(H,22,24)/b10-7+ |
| InChIKey | LGILXLOVNBRNKQ-JXMROGBWSA-N |
| XLogP | 3.33 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|