C18H21FN2O4 — CID 8663810
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 8663810) has the molecular formula C18H21FN2O4 and a molecular weight of 348.37 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8663810 |
| Molecular Formula | C18H21FN2O4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(F)cc1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H21FN2O4/c19-14-9-6-13(7-10-14)8-11-17(23)25-12-16(22)21-18(24)20-15-4-2-1-3-5-15/h6-11,15H,1-5,12H2,(H2,20,21,22,24)/b11-8+ |
| InChIKey | JHYNAXIHUOUCJZ-DHZHZOJOSA-N |
| XLogP | 2.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|