C13H14N2O4S — CID 8568538
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 8568538) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 8568538 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccsc1)NC(=O)NC1CC1 |
| InChI | InChI=1S/C13H14N2O4S/c16-11(15-13(18)14-10-2-3-10)7-19-12(17)4-1-9-5-6-20-8-9/h1,4-6,8,10H,2-3,7H2,(H2,14,15,16,18)/b4-1+ |
| InChIKey | SLXITHRSQZDBIT-DAFODLJHSA-N |
| XLogP | 1.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|