C15H17BrN2O5 — CID 6059042
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 6059042) has the molecular formula C15H17BrN2O5 and a molecular weight of 385.21 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 6059042 |
| Molecular Formula | C15H17BrN2O5 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(Br)o1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H17BrN2O5/c16-12-7-5-11(23-12)6-8-14(20)22-9-13(19)18-15(21)17-10-3-1-2-4-10/h5-8,10H,1-4,9H2,(H2,17,18,19,21)/b8-6+ |
| InChIKey | IMDKLGSYBAZUIQ-SOFGYWHQSA-N |
| XLogP | 2.37 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|