C13H15BrN2O5 — CID 4313377
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 4313377) has the molecular formula C13H15BrN2O5 and a molecular weight of 359.18 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4313377 |
| Molecular Formula | C13H15BrN2O5 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)C=Cc1ccc(Br)o1 |
| InChI | InChI=1S/C13H15BrN2O5/c1-8(2)15-13(19)16-11(17)7-20-12(18)6-4-9-3-5-10(14)21-9/h3-6,8H,7H2,1-2H3,(H2,15,16,17,19) |
| InChIKey | GKCGUVZFFMSUEH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|