C15H10BrCl2NO4 — CID 2348270
[2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 2348270) has the molecular formula C15H10BrCl2NO4 and a molecular weight of 419.06 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2348270 |
| Molecular Formula | C15H10BrCl2NO4 |
| Molecular Weight | 419.06 g/mol |
| Exact Mass | 416.92 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(Br)o1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H10BrCl2NO4/c16-13-3-1-12(23-13)2-4-15(21)22-8-14(20)19-11-6-9(17)5-10(18)7-11/h1-7H,8H2,(H,19,20)/b4-2+ |
| InChIKey | VVSADRYRGGGRNJ-DUXPYHPUSA-N |
| XLogP | 4.54 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.06 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|