C18H19BrN2O6S — CID 5035643
[2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 5035643) has the molecular formula C18H19BrN2O6S and a molecular weight of 471.33 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 5035643 |
| Molecular Formula | C18H19BrN2O6S |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C=Cc2ccc(Br)o2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C18H19BrN2O6S/c1-12-4-5-13(10-15(12)28(24,25)21(2)3)20-17(22)11-26-18(23)9-7-14-6-8-16(19)27-14/h4-10H,11H2,1-3H3,(H,20,22) |
| InChIKey | LUCCZMYRCSOOJK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|