C15H10Br2FNO4 — CID 3335877
[2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 3335877) has the molecular formula C15H10Br2FNO4 and a molecular weight of 447.05 g/mol. Its IUPAC name is [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3335877 |
| Molecular Formula | C15H10Br2FNO4 |
| Molecular Weight | 447.05 g/mol |
| Exact Mass | 444.90 |
| IUPAC Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(Br)o1)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H10Br2FNO4/c16-9-1-4-12(11(18)7-9)19-14(20)8-22-15(21)6-3-10-2-5-13(17)23-10/h1-7H,8H2,(H,19,20) |
| InChIKey | XMTCPGWTKDITNE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|