C17H14BrNO6 — CID 2385445
methyl 2-[[2-[(Z)-3-(5-bromofuran-2-yl)prop-2-enoyl]oxyacetyl]amino]benzoate (PubChem CID 2385445) has the molecular formula C17H14BrNO6 and a molecular weight of 408.20 g/mol. Its IUPAC name is methyl 2-[[2-[(Z)-3-(5-bromofuran-2-yl)prop-2-enoyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[(Z)-3-(5-bromofuran-2-yl)prop-2-enoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2385445 |
| Molecular Formula | C17H14BrNO6 |
| Molecular Weight | 408.20 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | methyl 2-[[2-[(Z)-3-(5-bromofuran-2-yl)prop-2-enoyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)/C=C\c1ccc(Br)o1 |
| InChI | InChI=1S/C17H14BrNO6/c1-23-17(22)12-4-2-3-5-13(12)19-15(20)10-24-16(21)9-7-11-6-8-14(18)25-11/h2-9H,10H2,1H3,(H,19,20)/b9-7- |
| InChIKey | RHNDAIUSKLAMDA-CLFYSBASSA-N |
| XLogP | 3.02 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|