C19H20BrNO4 — CID 7868659
[2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 7868659) has the molecular formula C19H20BrNO4 and a molecular weight of 406.28 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7868659 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | [2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | CCc1ccc([C@@H](C)NC(=O)COC(=O)/C=C/c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C19H20BrNO4/c1-3-14-4-6-15(7-5-14)13(2)21-18(22)12-24-19(23)11-9-16-8-10-17(20)25-16/h4-11,13H,3,12H2,1-2H3,(H,21,22)/b11-9+/t13-/m1/s1 |
| InChIKey | OIGLKCDAAUZNRJ-YGNAEDSMSA-N |
| XLogP | 4.04 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|