C16H16BrNO4 — CID 50929506
[2-[1-(4-methylphenyl)ethylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 50929506) has the molecular formula C16H16BrNO4 and a molecular weight of 366.21 g/mol. Its IUPAC name is [2-[1-(4-methylphenyl)ethylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-[1-(4-methylphenyl)ethylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 50929506 |
| Molecular Formula | C16H16BrNO4 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | [2-[1-(4-methylphenyl)ethylamino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | Cc1ccc(C(C)NC(=O)COC(=O)c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C16H16BrNO4/c1-10-3-5-12(6-4-10)11(2)18-15(19)9-21-16(20)13-7-8-14(17)22-13/h3-8,11H,9H2,1-2H3,(H,18,19) |
| InChIKey | ACGUJEWOLIGYAY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |