C11H14BrNO4 — CID 2573846
[2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 2573846) has the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 2573846 |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | CC[C@H](C)NC(=O)COC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H14BrNO4/c1-3-7(2)13-10(14)6-16-11(15)8-4-5-9(12)17-8/h4-5,7H,3,6H2,1-2H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | DXLULXKPFDSTMS-ZETCQYMHSA-N |
| XLogP | 2.11 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |