C13H18BrNO4 — CID 2390481
[2-[di(propan-2-yl)amino]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 2390481) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is [2-[di(propan-2-yl)amino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 2390481 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | CC(C)N(C(=O)COC(=O)c1ccc(Br)o1)C(C)C |
| InChI | InChI=1S/C13H18BrNO4/c1-8(2)15(9(3)4)12(16)7-18-13(17)10-5-6-11(14)19-10/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | MFZXUKMJSFSUMJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |