C17H19BrN2O6S — CID 2434657
[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 2434657) has the molecular formula C17H19BrN2O6S and a molecular weight of 459.32 g/mol. Its IUPAC name is [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 2434657 |
| Molecular Formula | C17H19BrN2O6S |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)COC(=O)c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C17H19BrN2O6S/c1-3-20(4-2)27(23,24)13-7-5-12(6-8-13)19-16(21)11-25-17(22)14-9-10-15(18)26-14/h5-10H,3-4,11H2,1-2H3,(H,19,21) |
| InChIKey | ZZZGHEBWCNNESQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |