C24H30N2O7S — CID 55314415
butyl 4-[[2-[4-(diethylsulfamoyl)benzoyl]oxyacetyl]amino]benzoate (PubChem CID 55314415) has the molecular formula C24H30N2O7S and a molecular weight of 490.58 g/mol. Its IUPAC name is butyl 4-[[2-[4-(diethylsulfamoyl)benzoyl]oxyacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-(diethylsulfamoyl)benzoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 55314415 |
| Molecular Formula | C24H30N2O7S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | butyl 4-[[2-[4-(diethylsulfamoyl)benzoyl]oxyacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O7S/c1-4-7-16-32-23(28)18-8-12-20(13-9-18)25-22(27)17-33-24(29)19-10-14-21(15-11-19)34(30,31)26(5-2)6-3/h8-15H,4-7,16-17H2,1-3H3,(H,25,27) |
| InChIKey | SNSHPWPRLVONAC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|