C25H24F2N2O5S — CID 30276350
butyl 4-[[2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)acetyl]amino]benzoate (PubChem CID 30276350) has the molecular formula C25H24F2N2O5S and a molecular weight of 502.54 g/mol. Its IUPAC name is butyl 4-[[2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30276350 |
| Molecular Formula | C25H24F2N2O5S |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | butyl 4-[[2-(4-fluoro-N-(4-fluorophenyl)sulfonylanilino)acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H24F2N2O5S/c1-2-3-16-34-25(31)18-4-10-21(11-5-18)28-24(30)17-29(22-12-6-19(26)7-13-22)35(32,33)23-14-8-20(27)9-15-23/h4-15H,2-3,16-17H2,1H3,(H,28,30) |
| InChIKey | AFOTZHCFRIQFRR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|