C19H22FN3O5S — CID 92663958
ethyl 4-[[2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetyl]amino]benzoate (PubChem CID 92663958) has the molecular formula C19H22FN3O5S and a molecular weight of 423.47 g/mol. Its IUPAC name is ethyl 4-[[2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 92663958 |
| Molecular Formula | C19H22FN3O5S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | ethyl 4-[[2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(c2ccc(F)cc2)S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C19H22FN3O5S/c1-4-28-19(25)14-5-9-16(10-6-14)21-18(24)13-23(29(26,27)22(2)3)17-11-7-15(20)8-12-17/h5-12H,4,13H2,1-3H3,(H,21,24) |
| InChIKey | SSDLGPCUKBUFHO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |