C16H16F3N3O3S — CID 53283271
N-(3,4-difluorophenyl)-2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetamide (PubChem CID 53283271) has the molecular formula C16H16F3N3O3S and a molecular weight of 387.38 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetamide |
|---|---|
| PubChem CID | 53283271 |
| Molecular Formula | C16H16F3N3O3S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetamide |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)Nc1ccc(F)c(F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16F3N3O3S/c1-21(2)26(24,25)22(13-6-3-11(17)4-7-13)10-16(23)20-12-5-8-14(18)15(19)9-12/h3-9H,10H2,1-2H3,(H,20,23) |
| InChIKey | QDMKWDSYXPDSPJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |