C11H16FN3O3S — CID 35329297
2-[dimethylsulfamoyl(methyl)amino]-N-(4-fluorophenyl)acetamide (PubChem CID 35329297) has the molecular formula C11H16FN3O3S and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[dimethylsulfamoyl(methyl)amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[dimethylsulfamoyl(methyl)amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 35329297 |
| Molecular Formula | C11H16FN3O3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[dimethylsulfamoyl(methyl)amino]-N-(4-fluorophenyl)acetamide |
| SMILES | CN(C)S(=O)(=O)N(C)CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C11H16FN3O3S/c1-14(2)19(17,18)15(3)8-11(16)13-10-6-4-9(12)5-7-10/h4-7H,8H2,1-3H3,(H,13,16) |
| InChIKey | HOBZEXUZSWNPCX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |