C11H15Cl2N3O3S — CID 35303305
N-(3,4-dichlorophenyl)-2-[dimethylsulfamoyl(methyl)amino]acetamide (PubChem CID 35303305) has the molecular formula C11H15Cl2N3O3S and a molecular weight of 340.23 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[dimethylsulfamoyl(methyl)amino]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[dimethylsulfamoyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 35303305 |
| Molecular Formula | C11H15Cl2N3O3S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[dimethylsulfamoyl(methyl)amino]acetamide |
| SMILES | CN(C)S(=O)(=O)N(C)CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2N3O3S/c1-15(2)20(18,19)16(3)7-11(17)14-8-4-5-9(12)10(13)6-8/h4-6H,7H2,1-3H3,(H,14,17) |
| InChIKey | ADSLMZYSHXCRSB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |