C13H19Cl2N3O3S — CID 31070757
N-(3,4-dichlorophenyl)-2-[diethylsulfamoyl(methyl)amino]acetamide (PubChem CID 31070757) has the molecular formula C13H19Cl2N3O3S and a molecular weight of 368.29 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[diethylsulfamoyl(methyl)amino]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[diethylsulfamoyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 31070757 |
| Molecular Formula | C13H19Cl2N3O3S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[diethylsulfamoyl(methyl)amino]acetamide |
| SMILES | CCN(CC)S(=O)(=O)N(C)CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2N3O3S/c1-4-18(5-2)22(20,21)17(3)9-13(19)16-10-6-7-11(14)12(15)8-10/h6-8H,4-5,9H2,1-3H3,(H,16,19) |
| InChIKey | WYNVOTSAZLZLKB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |