C13H16Cl2N2O3 — CID 60838290
2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-propan-2-ylamino]acetic acid (PubChem CID 60838290) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is 2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-propan-2-ylamino]acetic acid.
| Compound Name | 2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 60838290 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-propan-2-ylamino]acetic acid |
| SMILES | CC(C)N(CC(=O)O)CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2O3/c1-8(2)17(7-13(19)20)6-12(18)16-9-3-4-10(14)11(15)5-9/h3-5,8H,6-7H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | JVCPNDCOCHSVSR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |