C23H21FN2O5S — CID 1103794
ethyl 4-[[2-[N-(benzenesulfonyl)-4-fluoroanilino]acetyl]amino]benzoate (PubChem CID 1103794) has the molecular formula C23H21FN2O5S and a molecular weight of 456.50 g/mol. Its IUPAC name is ethyl 4-[[2-[N-(benzenesulfonyl)-4-fluoroanilino]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[N-(benzenesulfonyl)-4-fluoroanilino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 1103794 |
| Molecular Formula | C23H21FN2O5S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | ethyl 4-[[2-[N-(benzenesulfonyl)-4-fluoroanilino]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21FN2O5S/c1-2-31-23(28)17-8-12-19(13-9-17)25-22(27)16-26(20-14-10-18(24)11-15-20)32(29,30)21-6-4-3-5-7-21/h3-15H,2,16H2,1H3,(H,25,27) |
| InChIKey | JGNFSPIYXCOTRW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |