C24H23ClN2O5S — CID 30171209
ethyl 4-[[2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzoate (PubChem CID 30171209) has the molecular formula C24H23ClN2O5S and a molecular weight of 486.98 g/mol. Its IUPAC name is ethyl 4-[[2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30171209 |
| Molecular Formula | C24H23ClN2O5S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | ethyl 4-[[2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(c2ccc(Cl)cc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23ClN2O5S/c1-3-32-24(29)18-6-10-20(11-7-18)26-23(28)16-27(21-12-8-19(25)9-13-21)33(30,31)22-14-4-17(2)5-15-22/h4-15H,3,16H2,1-2H3,(H,26,28) |
| InChIKey | FBFPPMMEPVZJFR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |