C21H26N2O5S — CID 2519907
[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2,5-dimethylbenzoate (PubChem CID 2519907) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2,5-dimethylbenzoate.
| Compound Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 2519907 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2,5-dimethylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)COC(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-5-23(6-2)29(26,27)18-11-9-17(10-12-18)22-20(24)14-28-21(25)19-13-15(3)7-8-16(19)4/h7-13H,5-6,14H2,1-4H3,(H,22,24) |
| InChIKey | BPUSEPOVVQVBIM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |