C13H15BrClNO3 — CID 7950545
[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate (PubChem CID 7950545) has the molecular formula C13H15BrClNO3 and a molecular weight of 348.62 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate.
| Compound Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate |
|---|---|
| PubChem CID | 7950545 |
| Molecular Formula | C13H15BrClNO3 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate |
| SMILES | CC[C@@H](C)NC(=O)COC(=O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C13H15BrClNO3/c1-3-8(2)16-12(17)7-19-13(18)10-6-9(14)4-5-11(10)15/h4-6,8H,3,7H2,1-2H3,(H,16,17)/t8-/m1/s1 |
| InChIKey | WZTBRTSILZCODR-MRVPVSSYSA-N |
| XLogP | 3.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |